C40H27OPS4 — CID 102391294
4,14-bis(5-methylthiophen-2-yl)-8,9,10-triphenyl-3,15-dithia-9λ5-phosphatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2(6),4,7,10,13-hexaene 9-oxide (PubChem CID 102391294) has the molecular formula C40H27OPS4 and a molecular weight of 682.90 g/mol. Its IUPAC name is 4,14-bis(5-methylthiophen-2-yl)-8,9,10-triphenyl-3,15-dithia-9λ5-phosphatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2(6),4,7,10,13-hexaene 9-oxide.
| Compound Name | 4,14-bis(5-methylthiophen-2-yl)-8,9,10-triphenyl-3,15-dithia-9λ5-phosphatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2(6),4,7,10,13-hexaene 9-oxide |
|---|---|
| PubChem CID | 102391294 |
| Molecular Formula | C40H27OPS4 |
| Molecular Weight | 682.90 g/mol |
| Exact Mass | 682.07 |
| IUPAC Name | 4,14-bis(5-methylthiophen-2-yl)-8,9,10-triphenyl-3,15-dithia-9λ5-phosphatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2(6),4,7,10,13-hexaene 9-oxide |
| SMILES | Cc1ccc(-c2cc3c4c(c5cc(-c6ccc(C)s6)sc5c3s2)=C(c2ccccc2)P(=O)(c2ccccc2)C=4c2ccccc2)s1 |
| InChI | InChI=1S/C40H27OPS4/c1-24-18-20-31(43-24)33-22-29-35-36(30-23-34(32-21-19-25(2)44-32)46-40(30)39(29)45-33)38(27-14-8-4-9-15-27)42(41,28-16-10-5-11-17-28)37(35)26-12-6-3-7-13-26/h3-23H,1-2H3 |
| InChIKey | LATYPAIPAOTRAQ-UHFFFAOYSA-N |
| XLogP | 11.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.90 |
| LogP ≤ 5 | 11.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|