C31H34N2O8 — CID 102394466
1,3-bis[1-methyl-5-(3,4,5-trimethoxyphenyl)pyrrol-2-yl]propane-1,3-dione (PubChem CID 102394466) has the molecular formula C31H34N2O8 and a molecular weight of 562.62 g/mol. Its IUPAC name is 1,3-bis[1-methyl-5-(3,4,5-trimethoxyphenyl)pyrrol-2-yl]propane-1,3-dione.
| Compound Name | 1,3-bis[1-methyl-5-(3,4,5-trimethoxyphenyl)pyrrol-2-yl]propane-1,3-dione |
|---|---|
| PubChem CID | 102394466 |
| Molecular Formula | C31H34N2O8 |
| Molecular Weight | 562.62 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | 1,3-bis[1-methyl-5-(3,4,5-trimethoxyphenyl)pyrrol-2-yl]propane-1,3-dione |
| SMILES | COc1cc(-c2ccc(C(=O)CC(=O)c3ccc(-c4cc(OC)c(OC)c(OC)c4)n3C)n2C)cc(OC)c1OC |
| InChI | InChI=1S/C31H34N2O8/c1-32-20(18-13-26(36-3)30(40-7)27(14-18)37-4)9-11-22(32)24(34)17-25(35)23-12-10-21(33(23)2)19-15-28(38-5)31(41-8)29(16-19)39-6/h9-16H,17H2,1-8H3 |
| InChIKey | ONHLVKUTMUTHEW-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 99.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.62 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|