C15H25IO3 — CID 102396502
1-[(1S,2S,4S,5S)-4-heptyl-2-hydroxy-5-iodo-2-methyl-3-oxabicyclo[3.1.0]hexan-1-yl]ethanone (PubChem CID 102396502) has the molecular formula C15H25IO3 and a molecular weight of 380.27 g/mol. Its IUPAC name is 1-[(1S,2S,4S,5S)-4-heptyl-2-hydroxy-5-iodo-2-methyl-3-oxabicyclo[3.1.0]hexan-1-yl]ethanone.
| Compound Name | 1-[(1S,2S,4S,5S)-4-heptyl-2-hydroxy-5-iodo-2-methyl-3-oxabicyclo[3.1.0]hexan-1-yl]ethanone |
|---|---|
| PubChem CID | 102396502 |
| Molecular Formula | C15H25IO3 |
| Molecular Weight | 380.27 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 1-[(1S,2S,4S,5S)-4-heptyl-2-hydroxy-5-iodo-2-methyl-3-oxabicyclo[3.1.0]hexan-1-yl]ethanone |
| SMILES | CCCCCCC[C@@H]1O[C@](C)(O)[C@@]2(C(C)=O)C[C@@]12I |
| InChI | InChI=1S/C15H25IO3/c1-4-5-6-7-8-9-12-15(16)10-14(15,11(2)17)13(3,18)19-12/h12,18H,4-10H2,1-3H3/t12-,13-,14-,15+/m0/s1 |
| InChIKey | WGQXSYRYCQTKRU-ZQDZILKHSA-N |
| XLogP | 3.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.27 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|