C9H13NO — CID 102398243
1-methyl-4-prop-2-enyl-3,4-dihydropyridin-2-one (PubChem CID 102398243) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 1-methyl-4-prop-2-enyl-3,4-dihydropyridin-2-one.
| Compound Name | 1-methyl-4-prop-2-enyl-3,4-dihydropyridin-2-one |
|---|---|
| PubChem CID | 102398243 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 1-methyl-4-prop-2-enyl-3,4-dihydropyridin-2-one |
| SMILES | C=CCC1C=CN(C)C(=O)C1 |
| InChI | InChI=1S/C9H13NO/c1-3-4-8-5-6-10(2)9(11)7-8/h3,5-6,8H,1,4,7H2,2H3 |
| InChIKey | LRABUBZJLQEZGR-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|