C7H11INO- — CID 163648674
1-methyl-4-methyliodanuidyl-3,4-dihydropyridin-2-one (PubChem CID 163648674) has the molecular formula C7H11INO- and a molecular weight of 252.07 g/mol. Its IUPAC name is 1-methyl-4-methyliodanuidyl-3,4-dihydropyridin-2-one.
| Compound Name | 1-methyl-4-methyliodanuidyl-3,4-dihydropyridin-2-one |
|---|---|
| PubChem CID | 163648674 |
| Molecular Formula | C7H11INO- |
| Molecular Weight | 252.07 g/mol |
| Exact Mass | 251.99 |
| IUPAC Name | 1-methyl-4-methyliodanuidyl-3,4-dihydropyridin-2-one |
| SMILES | C[I-]C1C=CN(C)C(=O)C1 |
| InChI | InChI=1S/C7H11INO/c1-8-6-3-4-9(2)7(10)5-6/h3-4,6H,5H2,1-2H3/q-1 |
| InChIKey | MIOIWGGODVQQMF-UHFFFAOYSA-N |
| XLogP | -2.55 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.07 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|