C20H17NO — CID 102399005
(3R,4S)-3-methyl-4-naphthalen-2-yl-1-phenylazetidin-2-one (PubChem CID 102399005) has the molecular formula C20H17NO and a molecular weight of 287.36 g/mol. Its IUPAC name is (3R,4S)-3-methyl-4-naphthalen-2-yl-1-phenylazetidin-2-one.
| Compound Name | (3R,4S)-3-methyl-4-naphthalen-2-yl-1-phenylazetidin-2-one |
|---|---|
| PubChem CID | 102399005 |
| Molecular Formula | C20H17NO |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | (3R,4S)-3-methyl-4-naphthalen-2-yl-1-phenylazetidin-2-one |
| SMILES | C[C@H]1C(=O)N(c2ccccc2)[C@@H]1c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H17NO/c1-14-19(21(20(14)22)18-9-3-2-4-10-18)17-12-11-15-7-5-6-8-16(15)13-17/h2-14,19H,1H3/t14-,19+/m1/s1 |
| InChIKey | KCDNNGZRBFPWPJ-KUHUBIRLSA-N |
| XLogP | 4.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |