C22H29NO3 — CID 102399910
(3-methyl-3-azabicyclo[3.3.1]nonan-9-yl) (2S)-2-(cyclopenten-1-yl)-2-hydroxy-2-phenylacetate (PubChem CID 102399910) has the molecular formula C22H29NO3 and a molecular weight of 355.48 g/mol. Its IUPAC name is (3-methyl-3-azabicyclo[3.3.1]nonan-9-yl) (2S)-2-(cyclopenten-1-yl)-2-hydroxy-2-phenylacetate.
| Compound Name | (3-methyl-3-azabicyclo[3.3.1]nonan-9-yl) (2S)-2-(cyclopenten-1-yl)-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 102399910 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | (3-methyl-3-azabicyclo[3.3.1]nonan-9-yl) (2S)-2-(cyclopenten-1-yl)-2-hydroxy-2-phenylacetate |
| SMILES | CN1CC2CCCC(C1)C2OC(=O)[C@](O)(C1=CCCC1)c1ccccc1 |
| InChI | InChI=1S/C22H29NO3/c1-23-14-16-8-7-9-17(15-23)20(16)26-21(24)22(25,19-12-5-6-13-19)18-10-3-2-4-11-18/h2-4,10-12,16-17,20,25H,5-9,13-15H2,1H3/t16?,17?,20?,22-/m1/s1 |
| InChIKey | JSDIFSPBQQLQCA-OTPUIEDCSA-N |
| XLogP | 3.26 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|