C27H27NO3 — CID 68942830
(2-benzyl-2-azabicyclo[2.2.1]heptan-7-yl) 2-hydroxy-2,2-diphenylacetate (PubChem CID 68942830) has the molecular formula C27H27NO3 and a molecular weight of 413.52 g/mol. Its IUPAC name is (2-benzyl-2-azabicyclo[2.2.1]heptan-7-yl) 2-hydroxy-2,2-diphenylacetate.
| Compound Name | (2-benzyl-2-azabicyclo[2.2.1]heptan-7-yl) 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 68942830 |
| Molecular Formula | C27H27NO3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | (2-benzyl-2-azabicyclo[2.2.1]heptan-7-yl) 2-hydroxy-2,2-diphenylacetate |
| SMILES | O=C(OC1C2CCC1N(Cc1ccccc1)C2)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H27NO3/c29-26(27(30,22-12-6-2-7-13-22)23-14-8-3-9-15-23)31-25-21-16-17-24(25)28(19-21)18-20-10-4-1-5-11-20/h1-15,21,24-25,30H,16-19H2 |
| InChIKey | XRBUVYZOAHVXHA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |