C16H17IN2OS — CID 1024029
(5R)-N-benzyl-N-(furan-2-ylmethyl)-5-(iodomethyl)-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 1024029) has the molecular formula C16H17IN2OS and a molecular weight of 412.30 g/mol. Its IUPAC name is (5R)-N-benzyl-N-(furan-2-ylmethyl)-5-(iodomethyl)-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | (5R)-N-benzyl-N-(furan-2-ylmethyl)-5-(iodomethyl)-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 1024029 |
| Molecular Formula | C16H17IN2OS |
| Molecular Weight | 412.30 g/mol |
| Exact Mass | 412.01 |
| IUPAC Name | (5R)-N-benzyl-N-(furan-2-ylmethyl)-5-(iodomethyl)-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | IC[C@H]1CN=C(N(Cc2ccccc2)Cc2ccco2)S1 |
| InChI | InChI=1S/C16H17IN2OS/c17-9-15-10-18-16(21-15)19(12-14-7-4-8-20-14)11-13-5-2-1-3-6-13/h1-8,15H,9-12H2/t15-/m0/s1 |
| InChIKey | LLBJQRBRQZLNRQ-HNNXBMFYSA-N |
| XLogP | 4.19 |
| TPSA | 28.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.30 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|