C17H24N2O4Si — CID 102403521
2-O-benzyl 3-O-ethyl (3S)-5-trimethylsilyl-3,4-dihydropyrazole-2,3-dicarboxylate (PubChem CID 102403521) has the molecular formula C17H24N2O4Si and a molecular weight of 348.48 g/mol. Its IUPAC name is 2-O-benzyl 3-O-ethyl (3S)-5-trimethylsilyl-3,4-dihydropyrazole-2,3-dicarboxylate.
| Compound Name | 2-O-benzyl 3-O-ethyl (3S)-5-trimethylsilyl-3,4-dihydropyrazole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 102403521 |
| Molecular Formula | C17H24N2O4Si |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 2-O-benzyl 3-O-ethyl (3S)-5-trimethylsilyl-3,4-dihydropyrazole-2,3-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1CC([Si](C)(C)C)=NN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H24N2O4Si/c1-5-22-16(20)14-11-15(24(2,3)4)18-19(14)17(21)23-12-13-9-7-6-8-10-13/h6-10,14H,5,11-12H2,1-4H3/t14-/m0/s1 |
| InChIKey | YVXXYIYOHZZCHO-AWEZNQCLSA-N |
| XLogP | 3.19 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|