C17H13N5O5S — CID 102404638
6-(3-nitrophenyl)-4-(4-nitrophenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide (PubChem CID 102404638) has the molecular formula C17H13N5O5S and a molecular weight of 399.39 g/mol. Its IUPAC name is 6-(3-nitrophenyl)-4-(4-nitrophenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide.
| Compound Name | 6-(3-nitrophenyl)-4-(4-nitrophenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 102404638 |
| Molecular Formula | C17H13N5O5S |
| Molecular Weight | 399.39 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 6-(3-nitrophenyl)-4-(4-nitrophenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide |
| SMILES | NC(=O)C1=C(c2cccc([N+](=O)[O-])c2)NC(=S)NC1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H13N5O5S/c18-16(23)13-14(9-4-6-11(7-5-9)21(24)25)19-17(28)20-15(13)10-2-1-3-12(8-10)22(26)27/h1-8,14H,(H2,18,23)(H2,19,20,28) |
| InChIKey | DZHIXADPFKUALH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 153.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.39 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|