C26H28N6O5S — CID 73346081
(8E)-6-(2-morpholin-4-ylethyl)-4-(4-nitrophenyl)-8-[(3-nitrophenyl)methylidene]-3,4,5,7-tetrahydro-1H-pyrido[4,3-d]pyrimidine-2-thione (PubChem CID 73346081) has the molecular formula C26H28N6O5S and a molecular weight of 536.61 g/mol. Its IUPAC name is (8E)-6-(2-morpholin-4-ylethyl)-4-(4-nitrophenyl)-8-[(3-nitrophenyl)methylidene]-3,4,5,7-tetrahydro-1H-pyrido[4,3-d]pyrimidine-2-thione.
| Compound Name | (8E)-6-(2-morpholin-4-ylethyl)-4-(4-nitrophenyl)-8-[(3-nitrophenyl)methylidene]-3,4,5,7-tetrahydro-1H-pyrido[4,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 73346081 |
| Molecular Formula | C26H28N6O5S |
| Molecular Weight | 536.61 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | (8E)-6-(2-morpholin-4-ylethyl)-4-(4-nitrophenyl)-8-[(3-nitrophenyl)methylidene]-3,4,5,7-tetrahydro-1H-pyrido[4,3-d]pyrimidine-2-thione |
| SMILES | O=[N+]([O-])c1ccc(C2NC(=S)NC3=C2CN(CCN2CCOCC2)C/C3=C\c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C26H28N6O5S/c33-31(34)21-6-4-19(5-7-21)24-23-17-30(9-8-29-10-12-37-13-11-29)16-20(25(23)28-26(38)27-24)14-18-2-1-3-22(15-18)32(35)36/h1-7,14-15,24H,8-13,16-17H2,(H2,27,28,38)/b20-14+ |
| InChIKey | IMROSJFJTFKOFI-XSFVSMFZSA-N |
| XLogP | 3.01 |
| TPSA | 126.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.61 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|