C8H15NO3 — CID 102406303
(3S)-4,4-dimethyl-3-(nitromethyl)pentanal (PubChem CID 102406303) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is (3S)-4,4-dimethyl-3-(nitromethyl)pentanal.
| Compound Name | (3S)-4,4-dimethyl-3-(nitromethyl)pentanal |
|---|---|
| PubChem CID | 102406303 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | (3S)-4,4-dimethyl-3-(nitromethyl)pentanal |
| SMILES | CC(C)(C)[C@H](CC=O)C[N+](=O)[O-] |
| InChI | InChI=1S/C8H15NO3/c1-8(2,3)7(4-5-10)6-9(11)12/h5,7H,4,6H2,1-3H3/t7-/m1/s1 |
| InChIKey | YTIYFZMJEQESCY-SSDOTTSWSA-N |
| XLogP | 1.51 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|