About 3-(nitromethyl)hexanal
3-(nitromethyl)hexanal (PubChem CID 134999747) has the molecular formula C7H13NO3
and a molecular weight of 159.19 g/mol. Its IUPAC name is 3-(nitromethyl)hexanal.
Molecular Properties
| Compound Name | 3-(nitromethyl)hexanal |
| PubChem CID | 134999747 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | 3-(nitromethyl)hexanal |
| SMILES | CCCC(CC=O)C[N+](=O)[O-] |
| InChI | InChI=1S/C7H13NO3/c1-2-3-7(4-5-9)6-8(10)11/h5,7H,2-4,6H2,1H3 |
| InChIKey | SMXIANHTPRSPFW-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(nitromethyl)hexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(nitromethyl)hexanal?
The IUPAC name of 3-(nitromethyl)hexanal (CID 134999747) is 3-(nitromethyl)hexanal.
What is the SMILES notation for 3-(nitromethyl)hexanal?
The canonical SMILES for 3-(nitromethyl)hexanal is CCCC(CC=O)C[N+](=O)[O-].
What is the InChIKey of 3-(nitromethyl)hexanal?
The InChIKey is SMXIANHTPRSPFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO3/c1-2-3-7(4-5-9)6-8(10)11/h5,7H,2-4,6H2,1H3.
What are the key properties of 3-(nitromethyl)hexanal?
3-(nitromethyl)hexanal has a molecular weight of 159.19 g/mol, XLogP of 1.27, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(nitromethyl)hexanal is sourced from PubChem (CID 134999747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).