C11H18O3 — CID 102406712
(2E)-4-(oxan-2-yloxymethyl)penta-2,4-dien-1-ol (PubChem CID 102406712) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is (2E)-4-(oxan-2-yloxymethyl)penta-2,4-dien-1-ol.
| Compound Name | (2E)-4-(oxan-2-yloxymethyl)penta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 102406712 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | (2E)-4-(oxan-2-yloxymethyl)penta-2,4-dien-1-ol |
| SMILES | C=C(/C=C/CO)COC1CCCCO1 |
| InChI | InChI=1S/C11H18O3/c1-10(5-4-7-12)9-14-11-6-2-3-8-13-11/h4-5,11-12H,1-3,6-9H2/b5-4+ |
| InChIKey | KCEFHXVKADDZEQ-SNAWJCMRSA-N |
| XLogP | 1.63 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|