C17H21N — CID 102406838
11a-prop-2-enyl-6,7,8,9,10,11-hexahydrocycloocta[b]indole (PubChem CID 102406838) has the molecular formula C17H21N and a molecular weight of 239.36 g/mol. Its IUPAC name is 11a-prop-2-enyl-6,7,8,9,10,11-hexahydrocycloocta[b]indole.
| Compound Name | 11a-prop-2-enyl-6,7,8,9,10,11-hexahydrocycloocta[b]indole |
|---|---|
| PubChem CID | 102406838 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 11a-prop-2-enyl-6,7,8,9,10,11-hexahydrocycloocta[b]indole |
| SMILES | C=CCC12CCCCCCC1=Nc1ccccc12 |
| InChI | InChI=1S/C17H21N/c1-2-12-17-13-8-4-3-5-11-16(17)18-15-10-7-6-9-14(15)17/h2,6-7,9-10H,1,3-5,8,11-13H2 |
| InChIKey | IRVDLAOXHFXOCE-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|