C14H17NS — CID 10443910
4a-(methylsulfanylmethyl)-1,2,3,4-tetrahydrocarbazole (PubChem CID 10443910) has the molecular formula C14H17NS and a molecular weight of 231.36 g/mol. Its IUPAC name is 4a-(methylsulfanylmethyl)-1,2,3,4-tetrahydrocarbazole.
| Compound Name | 4a-(methylsulfanylmethyl)-1,2,3,4-tetrahydrocarbazole |
|---|---|
| PubChem CID | 10443910 |
| Molecular Formula | C14H17NS |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 4a-(methylsulfanylmethyl)-1,2,3,4-tetrahydrocarbazole |
| SMILES | CSCC12CCCCC1=Nc1ccccc12 |
| InChI | InChI=1S/C14H17NS/c1-16-10-14-9-5-4-8-13(14)15-12-7-3-2-6-11(12)14/h2-3,6-7H,4-5,8-10H2,1H3 |
| InChIKey | GFWGMLFDVZCFLU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |