C36H35FN2O11S — CID 102409307
[(2R,3R,4S,5R)-5-[3-benzoyl-5-(5-methylsulfonyloxypentyl)-2,4-dioxopyrimidin-1-yl]-3-benzoyloxy-4-fluorooxolan-2-yl]methyl benzoate (PubChem CID 102409307) has the molecular formula C36H35FN2O11S and a molecular weight of 722.74 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-5-[3-benzoyl-5-(5-methylsulfonyloxypentyl)-2,4-dioxopyrimidin-1-yl]-3-benzoyloxy-4-fluorooxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,5R)-5-[3-benzoyl-5-(5-methylsulfonyloxypentyl)-2,4-dioxopyrimidin-1-yl]-3-benzoyloxy-4-fluorooxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 102409307 |
| Molecular Formula | C36H35FN2O11S |
| Molecular Weight | 722.74 g/mol |
| Exact Mass | 722.19 |
| IUPAC Name | [(2R,3R,4S,5R)-5-[3-benzoyl-5-(5-methylsulfonyloxypentyl)-2,4-dioxopyrimidin-1-yl]-3-benzoyloxy-4-fluorooxolan-2-yl]methyl benzoate |
| SMILES | CS(=O)(=O)OCCCCCc1cn([C@@H]2O[C@H](COC(=O)c3ccccc3)[C@@H](OC(=O)c3ccccc3)[C@@H]2F)c(=O)n(C(=O)c2ccccc2)c1=O |
| InChI | InChI=1S/C36H35FN2O11S/c1-51(45,46)48-21-13-5-12-20-27-22-38(36(44)39(32(27)41)31(40)24-14-6-2-7-15-24)33-29(37)30(50-35(43)26-18-10-4-11-19-26)28(49-33)23-47-34(42)25-16-8-3-9-17-25/h2-4,6-11,14-19,22,28-30,33H,5,12-13,20-21,23H2,1H3/t28-,29+,30-,33-/m1/s1 |
| InChIKey | LUBYISGVGFEHHS-NDQSGYKOSA-N |
| XLogP | 3.71 |
| TPSA | 166.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.74 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|