C23H20BrFN2O7 — CID 166642238
[(2R,3R,4S,5R)-3-benzoyloxy-5-(5-bromo-2,4-dioxo-1,3-diazinan-1-yl)-4-fluorooxolan-2-yl]methyl benzoate (PubChem CID 166642238) has the molecular formula C23H20BrFN2O7 and a molecular weight of 535.32 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3-benzoyloxy-5-(5-bromo-2,4-dioxo-1,3-diazinan-1-yl)-4-fluorooxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,5R)-3-benzoyloxy-5-(5-bromo-2,4-dioxo-1,3-diazinan-1-yl)-4-fluorooxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 166642238 |
| Molecular Formula | C23H20BrFN2O7 |
| Molecular Weight | 535.32 g/mol |
| Exact Mass | 534.04 |
| IUPAC Name | [(2R,3R,4S,5R)-3-benzoyloxy-5-(5-bromo-2,4-dioxo-1,3-diazinan-1-yl)-4-fluorooxolan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1O[C@@H](N2CC(Br)C(=O)NC2=O)[C@@H](F)[C@@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H20BrFN2O7/c24-15-11-27(23(31)26-19(15)28)20-17(25)18(34-22(30)14-9-5-2-6-10-14)16(33-20)12-32-21(29)13-7-3-1-4-8-13/h1-10,15-18,20H,11-12H2,(H,26,28,31)/t15?,16-,17+,18-,20-/m1/s1 |
| InChIKey | OQRWEFLEIINREE-CMOVJTKZSA-N |
| XLogP | 2.45 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|