C30H25N3O11 — CID 15858690
[(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(5-nitro-2,4-dioxo-1,3-diazinan-1-yl)oxolan-2-yl]methyl benzoate (PubChem CID 15858690) has the molecular formula C30H25N3O11 and a molecular weight of 603.54 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(5-nitro-2,4-dioxo-1,3-diazinan-1-yl)oxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(5-nitro-2,4-dioxo-1,3-diazinan-1-yl)oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 15858690 |
| Molecular Formula | C30H25N3O11 |
| Molecular Weight | 603.54 g/mol |
| Exact Mass | 603.15 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(5-nitro-2,4-dioxo-1,3-diazinan-1-yl)oxolan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1O[C@@H](N2CC([N+](=O)[O-])C(=O)NC2=O)[C@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H25N3O11/c34-25-21(33(39)40)16-32(30(38)31-25)26-24(44-29(37)20-14-8-3-9-15-20)23(43-28(36)19-12-6-2-7-13-19)22(42-26)17-41-27(35)18-10-4-1-5-11-18/h1-15,21-24,26H,16-17H2,(H,31,34,38)/t21?,22-,23-,24-,26-/m1/s1 |
| InChIKey | GWTPVORKQJOIJF-CFDAROBKSA-N |
| XLogP | 2.22 |
| TPSA | 180.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.54 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|