C31H27F3N2O8 — CID 22796942
[(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[2-oxo-5-(trifluoromethyl)-1,3-diazinan-1-yl]oxolan-2-yl]methyl benzoate (PubChem CID 22796942) has the molecular formula C31H27F3N2O8 and a molecular weight of 612.56 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[2-oxo-5-(trifluoromethyl)-1,3-diazinan-1-yl]oxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[2-oxo-5-(trifluoromethyl)-1,3-diazinan-1-yl]oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 22796942 |
| Molecular Formula | C31H27F3N2O8 |
| Molecular Weight | 612.56 g/mol |
| Exact Mass | 612.17 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[2-oxo-5-(trifluoromethyl)-1,3-diazinan-1-yl]oxolan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1O[C@@H](N2CC(C(F)(F)F)CNC2=O)[C@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H27F3N2O8/c32-31(33,34)22-16-35-30(40)36(17-22)26-25(44-29(39)21-14-8-3-9-15-21)24(43-28(38)20-12-6-2-7-13-20)23(42-26)18-41-27(37)19-10-4-1-5-11-19/h1-15,22-26H,16-18H2,(H,35,40)/t22?,23-,24-,25-,26-/m1/s1 |
| InChIKey | RARAJYLHIOTFLR-AEFITHRKSA-N |
| XLogP | 4.22 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.56 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|