C17H18N2OS2 — CID 102413844
4,7-dibutyl-2-oxo-1,3-benzodithiole-5,6-dicarbonitrile (PubChem CID 102413844) has the molecular formula C17H18N2OS2 and a molecular weight of 330.48 g/mol. Its IUPAC name is 4,7-dibutyl-2-oxo-1,3-benzodithiole-5,6-dicarbonitrile.
| Compound Name | 4,7-dibutyl-2-oxo-1,3-benzodithiole-5,6-dicarbonitrile |
|---|---|
| PubChem CID | 102413844 |
| Molecular Formula | C17H18N2OS2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 4,7-dibutyl-2-oxo-1,3-benzodithiole-5,6-dicarbonitrile |
| SMILES | CCCCc1c(C#N)c(C#N)c(CCCC)c2sc(=O)sc12 |
| InChI | InChI=1S/C17H18N2OS2/c1-3-5-7-11-13(9-18)14(10-19)12(8-6-4-2)16-15(11)21-17(20)22-16/h3-8H2,1-2H3 |
| InChIKey | JIDDASCQWGNZRQ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 64.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |