C17H20O3 — CID 102414455
cis-ethyl (1S,3S)-3-[2-(4-methoxyphenyl)ethynyl]-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 102414455) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is cis-ethyl (1S,3S)-3-[2-(4-methoxyphenyl)ethynyl]-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | cis-ethyl (1S,3S)-3-[2-(4-methoxyphenyl)ethynyl]-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 102414455 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | cis-ethyl (1S,3S)-3-[2-(4-methoxyphenyl)ethynyl]-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H](C#Cc2ccc(OC)cc2)C1(C)C |
| InChI | InChI=1S/C17H20O3/c1-5-20-16(18)15-14(17(15,2)3)11-8-12-6-9-13(19-4)10-7-12/h6-7,9-10,14-15H,5H2,1-4H3/t14-,15+/m0/s1 |
| InChIKey | OLXDIHWPDCICOP-LSDHHAIUSA-N |
| XLogP | 2.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|