C29H25NO6 — CID 141438569
ethyl (3R,4R)-3-[(4-methoxybenzoyl)amino]-4-[2-(4-methylphenyl)ethynyl]-2-oxo-4H-chromene-3-carboxylate (PubChem CID 141438569) has the molecular formula C29H25NO6 and a molecular weight of 483.52 g/mol. Its IUPAC name is ethyl (3R,4R)-3-[(4-methoxybenzoyl)amino]-4-[2-(4-methylphenyl)ethynyl]-2-oxo-4H-chromene-3-carboxylate.
| Compound Name | ethyl (3R,4R)-3-[(4-methoxybenzoyl)amino]-4-[2-(4-methylphenyl)ethynyl]-2-oxo-4H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 141438569 |
| Molecular Formula | C29H25NO6 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | ethyl (3R,4R)-3-[(4-methoxybenzoyl)amino]-4-[2-(4-methylphenyl)ethynyl]-2-oxo-4H-chromene-3-carboxylate |
| SMILES | CCOC(=O)[C@@]1(NC(=O)c2ccc(OC)cc2)C(=O)Oc2ccccc2[C@H]1C#Cc1ccc(C)cc1 |
| InChI | InChI=1S/C29H25NO6/c1-4-35-27(32)29(30-26(31)21-14-16-22(34-3)17-15-21)24(18-13-20-11-9-19(2)10-12-20)23-7-5-6-8-25(23)36-28(29)33/h5-12,14-17,24H,4H2,1-3H3,(H,30,31)/t24-,29-/m1/s1 |
| InChIKey | GGLDNWUDCHLOCK-FUFSCUOVSA-N |
| XLogP | 3.79 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|