C48H37O2PS2 — CID 102414973
10,16-di(anthracen-9-yl)-13-sulfanyl-13-sulfido-12,14-dioxa-13-phosphoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(23),2,8,10,15,17-hexaene (PubChem CID 102414973) has the molecular formula C48H37O2PS2 and a molecular weight of 740.93 g/mol. Its IUPAC name is 10,16-di(anthracen-9-yl)-13-sulfanyl-13-sulfido-12,14-dioxa-13-phosphoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(23),2,8,10,15,17-hexaene.
| Compound Name | 10,16-di(anthracen-9-yl)-13-sulfanyl-13-sulfido-12,14-dioxa-13-phosphoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(23),2,8,10,15,17-hexaene |
|---|---|
| PubChem CID | 102414973 |
| Molecular Formula | C48H37O2PS2 |
| Molecular Weight | 740.93 g/mol |
| Exact Mass | 740.20 |
| IUPAC Name | 10,16-di(anthracen-9-yl)-13-sulfanyl-13-sulfido-12,14-dioxa-13-phosphoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(23),2,8,10,15,17-hexaene |
| SMILES | [S-][P+]1(S)Oc2c(-c3c4ccccc4cc4ccccc34)cc3c(c2-c2c4c(cc(-c5c6ccccc6cc6ccccc56)c2O1)CCCC4)CCCC3 |
| InChI | InChI=1S/C48H37O2PS2/c52-51(53)49-47-41(43-35-19-7-1-13-29(35)25-30-14-2-8-20-36(30)43)27-33-17-5-11-23-39(33)45(47)46-40-24-12-6-18-34(40)28-42(48(46)50-51)44-37-21-9-3-15-31(37)26-32-16-4-10-22-38(32)44/h1-4,7-10,13-16,19-22,25-28H,5-6,11-12,17-18,23-24H2,(H,52,53) |
| InChIKey | IYKQSSZGWQHOQM-UHFFFAOYSA-N |
| XLogP | 13.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.93 |
| LogP ≤ 5 | 13.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|