C44H33O2PS2 — CID 178184103
4,8-di(anthracen-9-yl)-1,2,10,11-tetramethyl-6-sulfanyl-6-sulfanylidenebenzo[d][1,3,2]benzodioxaphosphepine (PubChem CID 178184103) has the molecular formula C44H33O2PS2 and a molecular weight of 688.85 g/mol. Its IUPAC name is 4,8-di(anthracen-9-yl)-1,2,10,11-tetramethyl-6-sulfanyl-6-sulfanylidenebenzo[d][1,3,2]benzodioxaphosphepine.
| Compound Name | 4,8-di(anthracen-9-yl)-1,2,10,11-tetramethyl-6-sulfanyl-6-sulfanylidenebenzo[d][1,3,2]benzodioxaphosphepine |
|---|---|
| PubChem CID | 178184103 |
| Molecular Formula | C44H33O2PS2 |
| Molecular Weight | 688.85 g/mol |
| Exact Mass | 688.17 |
| IUPAC Name | 4,8-di(anthracen-9-yl)-1,2,10,11-tetramethyl-6-sulfanyl-6-sulfanylidenebenzo[d][1,3,2]benzodioxaphosphepine |
| SMILES | Cc1cc(-c2c3ccccc3cc3ccccc23)c2c(c1C)-c1c(C)c(C)cc(-c3c4ccccc4cc4ccccc34)c1OP(=S)(S)O2 |
| InChI | InChI=1S/C44H33O2PS2/c1-25-21-37(41-33-17-9-5-13-29(33)23-30-14-6-10-18-34(30)41)43-39(27(25)3)40-28(4)26(2)22-38(44(40)46-47(48,49)45-43)42-35-19-11-7-15-31(35)24-32-16-8-12-20-36(32)42/h5-24H,1-4H3,(H,48,49) |
| InChIKey | HJUYLHOWBHTZIK-UHFFFAOYSA-N |
| XLogP | 13.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.85 |
| LogP ≤ 5 | 13.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|