C22H17O2PS2 — CID 164665042
10,16-dimethyl-13-sulfanyl-13-sulfanylidene-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene (PubChem CID 164665042) has the molecular formula C22H17O2PS2 and a molecular weight of 408.48 g/mol. Its IUPAC name is 10,16-dimethyl-13-sulfanyl-13-sulfanylidene-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene.
| Compound Name | 10,16-dimethyl-13-sulfanyl-13-sulfanylidene-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene |
|---|---|
| PubChem CID | 164665042 |
| Molecular Formula | C22H17O2PS2 |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | 10,16-dimethyl-13-sulfanyl-13-sulfanylidene-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene |
| SMILES | Cc1cc2ccccc2c2c1OP(=S)(S)Oc1c(C)cc3ccccc3c1-2 |
| InChI | InChI=1S/C22H17O2PS2/c1-13-11-15-7-3-5-9-17(15)19-20-18-10-6-4-8-16(18)12-14(2)22(20)24-25(26,27)23-21(13)19/h3-12H,1-2H3,(H,26,27) |
| InChIKey | OZOIACNHZKUDNP-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|