C11H8O — CID 141434022
2-methylnaphtho[1,2-b]oxirene (PubChem CID 141434022) has the molecular formula C11H8O and a molecular weight of 156.18 g/mol. Its IUPAC name is 2-methylnaphtho[1,2-b]oxirene.
| Compound Name | 2-methylnaphtho[1,2-b]oxirene |
|---|---|
| PubChem CID | 141434022 |
| Molecular Formula | C11H8O |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | 2-methylnaphtho[1,2-b]oxirene |
| SMILES | Cc1cc2ccccc2c2c1O2 |
| InChI | InChI=1S/C11H8O/c1-7-6-8-4-2-3-5-9(8)11-10(7)12-11/h2-6H,1H3 |
| InChIKey | AMPKNBIBBSWWOF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|