C96H72CaO8P2 — CID 139257087
calcium bis(13-oxido-10,16-di(phenanthren-9-yl)-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(23),2,8,10,15,17-hexaene 13-oxide) (PubChem CID 139257087) has the molecular formula C96H72CaO8P2 and a molecular weight of 1455.65 g/mol. Its IUPAC name is calcium bis(13-oxido-10,16-di(phenanthren-9-yl)-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(23),2,8,10,15,17-hexaene 13-oxide).
| Compound Name | calcium bis(13-oxido-10,16-di(phenanthren-9-yl)-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(23),2,8,10,15,17-hexaene 13-oxide) |
|---|---|
| PubChem CID | 139257087 |
| Molecular Formula | C96H72CaO8P2 |
| Molecular Weight | 1455.65 g/mol |
| Exact Mass | 1454.43 |
| IUPAC Name | calcium bis(13-oxido-10,16-di(phenanthren-9-yl)-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(23),2,8,10,15,17-hexaene 13-oxide) |
| SMILES | O=P1([O-])Oc2c(-c3cc4ccccc4c4ccccc34)cc3c(c2-c2c4c(cc(-c5cc6ccccc6c6ccccc56)c2O1)CCCC4)CCCC3.O=P1([O-])Oc2c(-c3cc4ccccc4c4ccccc34)cc3c(c2-c2c4c(cc(-c5cc6ccccc6c6ccccc56)c2O1)CCCC4)CCCC3.[Ca+2] |
| InChI | InChI=1S/2C48H37O4P.Ca/c2*49-53(50)51-47-43(41-25-29-13-1-5-17-33(29)37-21-9-11-23-39(37)41)27-31-15-3-7-19-35(31)45(47)46-36-20-8-4-16-32(36)28-44(48(46)52-53)42-26-30-14-2-6-18-34(30)38-22-10-12-24-40(38)42;/h2*1-2,5-6,9-14,17-18,21-28H,3-4,7-8,15-16,19-20H2,(H,49,50);/q;;+2/p-2 |
| InChIKey | XFXZXEIZCAQYDQ-UHFFFAOYSA-L |
| XLogP | 24.21 |
| TPSA | 117.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 107 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1455.65 |
| LogP ≤ 5 | 24.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|