C48H35F3NO5PS — CID 167993505
N-[3,8-dimethyl-12-oxo-1,10-di(phenanthren-9-yl)-4,5,6,7-tetrahydroiindeno[7,1-de:1',7'-fg][1,3,2]dioxaphosphocin-12-yl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 167993505) has the molecular formula C48H35F3NO5PS and a molecular weight of 825.85 g/mol. Its IUPAC name is N-[3,8-dimethyl-12-oxo-1,10-di(phenanthren-9-yl)-4,5,6,7-tetrahydroiindeno[7,1-de:1',7'-fg][1,3,2]dioxaphosphocin-12-yl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[3,8-dimethyl-12-oxo-1,10-di(phenanthren-9-yl)-4,5,6,7-tetrahydroiindeno[7,1-de:1',7'-fg][1,3,2]dioxaphosphocin-12-yl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 167993505 |
| Molecular Formula | C48H35F3NO5PS |
| Molecular Weight | 825.85 g/mol |
| Exact Mass | 825.19 |
| IUPAC Name | N-[3,8-dimethyl-12-oxo-1,10-di(phenanthren-9-yl)-4,5,6,7-tetrahydroiindeno[7,1-de:1',7'-fg][1,3,2]dioxaphosphocin-12-yl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | Cc1cc(-c2cc3ccccc3c3ccccc23)c2c3c1CCC31CCc3c(C)cc(-c4cc5ccccc5c5ccccc45)c(c31)OP(=O)(NS(=O)(=O)C(F)(F)F)O2 |
| InChI | InChI=1S/C48H35F3NO5PS/c1-27-23-41(39-25-29-11-3-5-13-33(29)35-15-7-9-17-37(35)39)45-43-31(27)19-21-47(43)22-20-32-28(2)24-42(40-26-30-12-4-6-14-34(30)36-16-8-10-18-38(36)40)46(44(32)47)57-58(53,56-45)52-59(54,55)48(49,50)51/h3-18,23-26H,19-22H2,1-2H3,(H,52,53) |
| InChIKey | UXCJYZHSZVCCHD-UHFFFAOYSA-N |
| XLogP | 12.75 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.85 |
| LogP ≤ 5 | 12.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|