C47H33F3NO5PS — CID 102228836
N-(10,16-dibenzhydryl-13-oxo-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yl)-1,1,1-trifluoromethanesulfonamide (PubChem CID 102228836) has the molecular formula C47H33F3NO5PS and a molecular weight of 811.82 g/mol. Its IUPAC name is N-(10,16-dibenzhydryl-13-oxo-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yl)-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-(10,16-dibenzhydryl-13-oxo-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yl)-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 102228836 |
| Molecular Formula | C47H33F3NO5PS |
| Molecular Weight | 811.82 g/mol |
| Exact Mass | 811.18 |
| IUPAC Name | N-(10,16-dibenzhydryl-13-oxo-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yl)-1,1,1-trifluoromethanesulfonamide |
| SMILES | O=P1(NS(=O)(=O)C(F)(F)F)Oc2c(C(c3ccccc3)c3ccccc3)cc3ccccc3c2-c2c(c(C(c3ccccc3)c3ccccc3)cc3ccccc23)O1 |
| InChI | InChI=1S/C47H33F3NO5PS/c48-47(49,50)58(53,54)51-57(52)55-45-39(41(31-17-5-1-6-18-31)32-19-7-2-8-20-32)29-35-25-13-15-27-37(35)43(45)44-38-28-16-14-26-36(38)30-40(46(44)56-57)42(33-21-9-3-10-22-33)34-23-11-4-12-24-34/h1-30,41-42H,(H,51,52) |
| InChIKey | YHBOAFOUSAEIFP-UHFFFAOYSA-N |
| XLogP | 12.34 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.82 |
| LogP ≤ 5 | 12.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|