C46H30Li2O8P2 — CID 102083372
dilithium;2-oxido-10-(2-oxido-2-oxo-4,4-diphenylbenzo[g][1,3,2]benzodioxaphosphinin-10-yl)-4,4-diphenylbenzo[g][1,3,2]benzodioxaphosphinine 2-oxide (PubChem CID 102083372) has the molecular formula C46H30Li2O8P2 and a molecular weight of 786.57 g/mol. Its IUPAC name is dilithium;2-oxido-10-(2-oxido-2-oxo-4,4-diphenylbenzo[g][1,3,2]benzodioxaphosphinin-10-yl)-4,4-diphenylbenzo[g][1,3,2]benzodioxaphosphinine 2-oxide.
| Compound Name | dilithium;2-oxido-10-(2-oxido-2-oxo-4,4-diphenylbenzo[g][1,3,2]benzodioxaphosphinin-10-yl)-4,4-diphenylbenzo[g][1,3,2]benzodioxaphosphinine 2-oxide |
|---|---|
| PubChem CID | 102083372 |
| Molecular Formula | C46H30Li2O8P2 |
| Molecular Weight | 786.57 g/mol |
| Exact Mass | 786.17 |
| IUPAC Name | dilithium;2-oxido-10-(2-oxido-2-oxo-4,4-diphenylbenzo[g][1,3,2]benzodioxaphosphinin-10-yl)-4,4-diphenylbenzo[g][1,3,2]benzodioxaphosphinine 2-oxide |
| SMILES | O=P1([O-])Oc2c(cc3ccccc3c2-c2c3c(cc4ccccc24)C(c2ccccc2)(c2ccccc2)OP(=O)([O-])O3)C(c2ccccc2)(c2ccccc2)O1.[Li+].[Li+] |
| InChI | InChI=1S/C46H32O8P2.2Li/c47-55(48)51-43-39(45(53-55,33-19-5-1-6-20-33)34-21-7-2-8-22-34)29-31-17-13-15-27-37(31)41(43)42-38-28-16-14-18-32(38)30-40-44(42)52-56(49,50)54-46(40,35-23-9-3-10-24-35)36-25-11-4-12-26-36;;/h1-30H,(H,47,48)(H,49,50);;/q;2*+1/p-2 |
| InChIKey | HDZNBGFPLFORDK-UHFFFAOYSA-L |
| XLogP | 4.01 |
| TPSA | 117.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|