C12H20O4 — CID 102415899
methyl 8,8-dimethoxybicyclo[3.2.1]octane-6-carboxylate (PubChem CID 102415899) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is methyl 8,8-dimethoxybicyclo[3.2.1]octane-6-carboxylate.
| Compound Name | methyl 8,8-dimethoxybicyclo[3.2.1]octane-6-carboxylate |
|---|---|
| PubChem CID | 102415899 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | methyl 8,8-dimethoxybicyclo[3.2.1]octane-6-carboxylate |
| SMILES | COC(=O)C1CC2CCCC1C2(OC)OC |
| InChI | InChI=1S/C12H20O4/c1-14-11(13)9-7-8-5-4-6-10(9)12(8,15-2)16-3/h8-10H,4-7H2,1-3H3 |
| InChIKey | GHCSDWQQMRCAHQ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|