About methyl 2,4-dimethyltricyclo[3.2.2.02,4]nonane-6-carboxylate
methyl 2,4-dimethyltricyclo[3.2.2.02,4]nonane-6-carboxylate (PubChem CID 130331695) has the molecular formula C13H20O2
and a molecular weight of 208.30 g/mol. Its IUPAC name is methyl 2,4-dimethyltricyclo[3.2.2.02,4]nonane-6-carboxylate.
Analyze methyl 2,4-dimethyltricyclo[3.2.2.02,4]nonane-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2,4-dimethyltricyclo[3.2.2.02,4]nonane-6-carboxylate?
The IUPAC name of methyl 2,4-dimethyltricyclo[3.2.2.02,4]nonane-6-carboxylate (CID 130331695) is methyl 2,4-dimethyltricyclo[3.2.2.02,4]nonane-6-carboxylate.
What is the SMILES notation for methyl 2,4-dimethyltricyclo[3.2.2.02,4]nonane-6-carboxylate?
The canonical SMILES for methyl 2,4-dimethyltricyclo[3.2.2.02,4]nonane-6-carboxylate is COC(=O)C1CC2CCC1C1(C)CC21C.
What is the InChIKey of methyl 2,4-dimethyltricyclo[3.2.2.02,4]nonane-6-carboxylate?
The InChIKey is ZLKZMIJSIOGEDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O2/c1-12-7-13(12,2)10-5-4-8(12)6-9(10)11(14)15-3/h8-10H,4-7H2,1-3H3.
What are the key properties of methyl 2,4-dimethyltricyclo[3.2.2.02,4]nonane-6-carboxylate?
methyl 2,4-dimethyltricyclo[3.2.2.02,4]nonane-6-carboxylate has a molecular weight of 208.30 g/mol, XLogP of 2.62, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,4-dimethyltricyclo[3.2.2.02,4]nonane-6-carboxylate is sourced from PubChem (CID 130331695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).