C17H24N4O5 — CID 102415986
2-[2-[[(4-methoxyphenyl)diazenyl]-methylamino]ethoxycarbonylamino]ethyl 2-methylprop-2-enoate (PubChem CID 102415986) has the molecular formula C17H24N4O5 and a molecular weight of 364.40 g/mol. Its IUPAC name is 2-[2-[[(4-methoxyphenyl)diazenyl]-methylamino]ethoxycarbonylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[[(4-methoxyphenyl)diazenyl]-methylamino]ethoxycarbonylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 102415986 |
| Molecular Formula | C17H24N4O5 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 2-[2-[[(4-methoxyphenyl)diazenyl]-methylamino]ethoxycarbonylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCCN(C)/N=N/c1ccc(OC)cc1 |
| InChI | InChI=1S/C17H24N4O5/c1-13(2)16(22)25-11-9-18-17(23)26-12-10-21(3)20-19-14-5-7-15(24-4)8-6-14/h5-8H,1,9-12H2,2-4H3,(H,18,23)/b20-19+ |
| InChIKey | CYMGHFFVTCSKQB-FMQUCBEESA-N |
| XLogP | 2.47 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|