C18H23N3O4 — CID 171590773
2-[methyl-[[4-(2-methylprop-2-enoyloxymethyl)phenyl]diazenyl]amino]ethyl 2-methylprop-2-enoate (PubChem CID 171590773) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is 2-[methyl-[[4-(2-methylprop-2-enoyloxymethyl)phenyl]diazenyl]amino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[methyl-[[4-(2-methylprop-2-enoyloxymethyl)phenyl]diazenyl]amino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 171590773 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 2-[methyl-[[4-(2-methylprop-2-enoyloxymethyl)phenyl]diazenyl]amino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCN(C)/N=N/c1ccc(COC(=O)C(=C)C)cc1 |
| InChI | InChI=1S/C18H23N3O4/c1-13(2)17(22)24-11-10-21(5)20-19-16-8-6-15(7-9-16)12-25-18(23)14(3)4/h6-9H,1,3,10-12H2,2,4-5H3/b20-19+ |
| InChIKey | DQZPCDMSCXDFJG-FMQUCBEESA-N |
| XLogP | 3.36 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|