C81H60N6 — CID 102416901
4-[(E)-2-[4-[4,6-bis[4-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]-1,3,5-triazin-2-yl]phenyl]ethenyl]-N,N-diphenylaniline (PubChem CID 102416901) has the molecular formula C81H60N6 and a molecular weight of 1117.41 g/mol. Its IUPAC name is 4-[(E)-2-[4-[4,6-bis[4-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]-1,3,5-triazin-2-yl]phenyl]ethenyl]-N,N-diphenylaniline.
| Compound Name | 4-[(E)-2-[4-[4,6-bis[4-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]-1,3,5-triazin-2-yl]phenyl]ethenyl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 102416901 |
| Molecular Formula | C81H60N6 |
| Molecular Weight | 1117.41 g/mol |
| Exact Mass | 1116.49 |
| IUPAC Name | 4-[(E)-2-[4-[4,6-bis[4-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]-1,3,5-triazin-2-yl]phenyl]ethenyl]-N,N-diphenylaniline |
| SMILES | C(=C/c1ccc(N(c2ccccc2)c2ccccc2)cc1)\c1ccc(-c2nc(-c3ccc(/C=C/c4ccc(N(c5ccccc5)c5ccccc5)cc4)cc3)nc(-c3ccc(/C=C/c4ccc(N(c5ccccc5)c5ccccc5)cc4)cc3)n2)cc1 |
| InChI | InChI=1S/C81H60N6/c1-7-19-70(20-8-1)85(71-21-9-2-10-22-71)76-55-43-64(44-56-76)34-31-61-37-49-67(50-38-61)79-82-80(68-51-39-62(40-52-68)32-35-65-45-57-77(58-46-65)86(72-23-11-3-12-24-72)73-25-13-4-14-26-73)84-81(83-79)69-53-41-63(42-54-69)33-36-66-47-59-78(60-48-66)87(74-27-15-5-16-28-74)75-29-17-6-18-30-75/h1-60H/b34-31+,35-32+,36-33+ |
| InChIKey | GXLBRTFWFVXYND-JCLOTSFOSA-N |
| XLogP | 21.79 |
| TPSA | 48.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 87 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1117.41 |
| LogP ≤ 5 | 21.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|