C25H37N3O5 — CID 102418411
tert-butyl N-[(2S,3R)-2-methyl-3-(2-methyl-1H-indol-3-yl)-1-oxopentan-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate (PubChem CID 102418411) has the molecular formula C25H37N3O5 and a molecular weight of 459.59 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-2-methyl-3-(2-methyl-1H-indol-3-yl)-1-oxopentan-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate.
| Compound Name | tert-butyl N-[(2S,3R)-2-methyl-3-(2-methyl-1H-indol-3-yl)-1-oxopentan-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
|---|---|
| PubChem CID | 102418411 |
| Molecular Formula | C25H37N3O5 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.27 |
| IUPAC Name | tert-butyl N-[(2S,3R)-2-methyl-3-(2-methyl-1H-indol-3-yl)-1-oxopentan-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
| SMILES | CC[C@H](c1c(C)[nH]c2ccccc12)[C@@](C)(C=O)N(NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H37N3O5/c1-10-18(20-16(2)26-19-14-12-11-13-17(19)20)25(9,15-29)28(22(31)33-24(6,7)8)27-21(30)32-23(3,4)5/h11-15,18,26H,10H2,1-9H3,(H,27,30)/t18-,25-/m1/s1 |
| InChIKey | VHIOHMSFQNRFQH-IQGLISFBSA-N |
| XLogP | 5.60 |
| TPSA | 100.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|