C19H27N3O7 — CID 54577862
tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]-N-[(2S)-2-(2-nitrophenyl)-1-oxopropan-2-yl]carbamate (PubChem CID 54577862) has the molecular formula C19H27N3O7 and a molecular weight of 409.44 g/mol. Its IUPAC name is tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]-N-[(2S)-2-(2-nitrophenyl)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]-N-[(2S)-2-(2-nitrophenyl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 54577862 |
| Molecular Formula | C19H27N3O7 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]-N-[(2S)-2-(2-nitrophenyl)-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NN(C(=O)OC(C)(C)C)[C@](C)(C=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H27N3O7/c1-17(2,3)28-15(24)20-21(16(25)29-18(4,5)6)19(7,12-23)13-10-8-9-11-14(13)22(26)27/h8-12H,1-7H3,(H,20,24)/t19-/m1/s1 |
| InChIKey | VTXUZRVZFNCPFH-LJQANCHMSA-N |
| XLogP | 3.69 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|