C20H38N2O5S — CID 44512513
tert-butyl N-[(2R,3S)-3-tert-butylsulfanyl-2-methyl-1-oxopentan-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate (PubChem CID 44512513) has the molecular formula C20H38N2O5S and a molecular weight of 418.60 g/mol. Its IUPAC name is tert-butyl N-[(2R,3S)-3-tert-butylsulfanyl-2-methyl-1-oxopentan-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate.
| Compound Name | tert-butyl N-[(2R,3S)-3-tert-butylsulfanyl-2-methyl-1-oxopentan-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
|---|---|
| PubChem CID | 44512513 |
| Molecular Formula | C20H38N2O5S |
| Molecular Weight | 418.60 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | tert-butyl N-[(2R,3S)-3-tert-butylsulfanyl-2-methyl-1-oxopentan-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
| SMILES | CC[C@H](SC(C)(C)C)[C@@](C)(C=O)N(NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H38N2O5S/c1-12-14(28-19(8,9)10)20(11,13-23)22(16(25)27-18(5,6)7)21-15(24)26-17(2,3)4/h13-14H,12H2,1-11H3,(H,21,24)/t14-,20+/m0/s1 |
| InChIKey | QYZZZXMHIYKJPL-VBKZILBWSA-N |
| XLogP | 4.93 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.60 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|