C13H25NO4S2 — CID 123820538
tert-butyl N-[1-(tert-butyldisulfanyl)-2-formyl-3-hydroxypropan-2-yl]carbamate (PubChem CID 123820538) has the molecular formula C13H25NO4S2 and a molecular weight of 323.48 g/mol. Its IUPAC name is tert-butyl N-[1-(tert-butyldisulfanyl)-2-formyl-3-hydroxypropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(tert-butyldisulfanyl)-2-formyl-3-hydroxypropan-2-yl]carbamate |
|---|---|
| PubChem CID | 123820538 |
| Molecular Formula | C13H25NO4S2 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | tert-butyl N-[1-(tert-butyldisulfanyl)-2-formyl-3-hydroxypropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C=O)(CO)CSSC(C)(C)C |
| InChI | InChI=1S/C13H25NO4S2/c1-11(2,3)18-10(17)14-13(7-15,8-16)9-19-20-12(4,5)6/h7,16H,8-9H2,1-6H3,(H,14,17) |
| InChIKey | NECUTGXPESZWDC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|