C15H21NO — CID 102418687
N-(5-deuterio-2,2-dimethylpent-4-enyl)-4-methylbenzamide (PubChem CID 102418687) has the molecular formula C15H21NO and a molecular weight of 232.35 g/mol. Its IUPAC name is N-(5-deuterio-2,2-dimethylpent-4-enyl)-4-methylbenzamide.
| Compound Name | N-(5-deuterio-2,2-dimethylpent-4-enyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 102418687 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | N-(5-deuterio-2,2-dimethylpent-4-enyl)-4-methylbenzamide |
| SMILES | [2H]/C=C/CC(C)(C)CNC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H21NO/c1-5-10-15(3,4)11-16-14(17)13-8-6-12(2)7-9-13/h5-9H,1,10-11H2,2-4H3,(H,16,17)/i1D/b5-1+ |
| InChIKey | BXOOITYZAYRVPT-GCBGRLCTSA-N |
| XLogP | 3.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|