C27H14N6O — CID 102419327
3,3-bis(5-cyano-1H-indol-3-yl)-2-oxo-1H-indole-5-carbonitrile (PubChem CID 102419327) has the molecular formula C27H14N6O and a molecular weight of 438.45 g/mol. Its IUPAC name is 3,3-bis(5-cyano-1H-indol-3-yl)-2-oxo-1H-indole-5-carbonitrile.
| Compound Name | 3,3-bis(5-cyano-1H-indol-3-yl)-2-oxo-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 102419327 |
| Molecular Formula | C27H14N6O |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 3,3-bis(5-cyano-1H-indol-3-yl)-2-oxo-1H-indole-5-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)C(c1c[nH]c3ccc(C#N)cc13)(c1c[nH]c3ccc(C#N)cc13)C(=O)N2 |
| InChI | InChI=1S/C27H14N6O/c28-10-15-1-4-23-18(7-15)21(13-31-23)27(20-9-17(12-30)3-6-25(20)33-26(27)34)22-14-32-24-5-2-16(11-29)8-19(22)24/h1-9,13-14,31-32H,(H,33,34) |
| InChIKey | JRJOQSBBSXOFLT-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 132.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |