C19H21BFNO3 — CID 102419603
2-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylideneamino]phenol (PubChem CID 102419603) has the molecular formula C19H21BFNO3 and a molecular weight of 341.19 g/mol. Its IUPAC name is 2-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylideneamino]phenol.
| Compound Name | 2-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylideneamino]phenol |
|---|---|
| PubChem CID | 102419603 |
| Molecular Formula | C19H21BFNO3 |
| Molecular Weight | 341.19 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 2-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylideneamino]phenol |
| SMILES | CC1(C)OB(c2ccc(/C=N/c3ccccc3O)c(F)c2)OC1(C)C |
| InChI | InChI=1S/C19H21BFNO3/c1-18(2)19(3,4)25-20(24-18)14-10-9-13(15(21)11-14)12-22-16-7-5-6-8-17(16)23/h5-12,23H,1-4H3/b22-12+ |
| InChIKey | ITBZMMGFYMARRZ-WSDLNYQXSA-N |
| XLogP | 3.58 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.19 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|