C16H25IO7S — CID 102420938
[(3aR,5S,6S,6aR)-5-[(1S)-1-butylsulfanylcarbonyloxy-2-iodoethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] acetate (PubChem CID 102420938) has the molecular formula C16H25IO7S and a molecular weight of 488.34 g/mol. Its IUPAC name is [(3aR,5S,6S,6aR)-5-[(1S)-1-butylsulfanylcarbonyloxy-2-iodoethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] acetate.
| Compound Name | [(3aR,5S,6S,6aR)-5-[(1S)-1-butylsulfanylcarbonyloxy-2-iodoethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] acetate |
|---|---|
| PubChem CID | 102420938 |
| Molecular Formula | C16H25IO7S |
| Molecular Weight | 488.34 g/mol |
| Exact Mass | 488.04 |
| IUPAC Name | [(3aR,5S,6S,6aR)-5-[(1S)-1-butylsulfanylcarbonyloxy-2-iodoethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] acetate |
| SMILES | CCCCSC(=O)O[C@H](CI)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OC(C)=O |
| InChI | InChI=1S/C16H25IO7S/c1-5-6-7-25-15(19)21-10(8-17)11-12(20-9(2)18)13-14(22-11)24-16(3,4)23-13/h10-14H,5-8H2,1-4H3/t10-,11-,12+,13-,14-/m1/s1 |
| InChIKey | FEAWMRMOHWFJND-RKQHYHRCSA-N |
| XLogP | 3.27 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|