C29H36N2 — CID 102422975
4-[(2S)-6-methylhept-5-en-2-yl]-1-(4-methylpiperidin-1-yl)-9,10-dihydrophenanthrene-2-carbonitrile (PubChem CID 102422975) has the molecular formula C29H36N2 and a molecular weight of 412.62 g/mol. Its IUPAC name is 4-[(2S)-6-methylhept-5-en-2-yl]-1-(4-methylpiperidin-1-yl)-9,10-dihydrophenanthrene-2-carbonitrile.
| Compound Name | 4-[(2S)-6-methylhept-5-en-2-yl]-1-(4-methylpiperidin-1-yl)-9,10-dihydrophenanthrene-2-carbonitrile |
|---|---|
| PubChem CID | 102422975 |
| Molecular Formula | C29H36N2 |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 412.29 |
| IUPAC Name | 4-[(2S)-6-methylhept-5-en-2-yl]-1-(4-methylpiperidin-1-yl)-9,10-dihydrophenanthrene-2-carbonitrile |
| SMILES | CC(C)=CCC[C@H](C)c1cc(C#N)c(N2CCC(C)CC2)c2c1-c1ccccc1CC2 |
| InChI | InChI=1S/C29H36N2/c1-20(2)8-7-9-22(4)27-18-24(19-30)29(31-16-14-21(3)15-17-31)26-13-12-23-10-5-6-11-25(23)28(26)27/h5-6,8,10-11,18,21-22H,7,9,12-17H2,1-4H3/t22-/m0/s1 |
| InChIKey | RZWIZAADEKSOEI-QFIPXVFZSA-N |
| XLogP | 7.41 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|