C31H40N2O2 — CID 91167435
3,7,11-trimethyldodeca-2,6,10-trienyl 3-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-4-yl)-2-cyanoprop-2-enoate (PubChem CID 91167435) has the molecular formula C31H40N2O2 and a molecular weight of 472.67 g/mol. Its IUPAC name is 3,7,11-trimethyldodeca-2,6,10-trienyl 3-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-4-yl)-2-cyanoprop-2-enoate.
| Compound Name | 3,7,11-trimethyldodeca-2,6,10-trienyl 3-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-4-yl)-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 91167435 |
| Molecular Formula | C31H40N2O2 |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.31 |
| IUPAC Name | 3,7,11-trimethyldodeca-2,6,10-trienyl 3-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-4-yl)-2-cyanoprop-2-enoate |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCOC(=O)C(C#N)=CC1CCN2CCCc3cccc1c32 |
| InChI | InChI=1S/C31H40N2O2/c1-23(2)9-5-10-24(3)11-6-12-25(4)17-20-35-31(34)28(22-32)21-27-16-19-33-18-8-14-26-13-7-15-29(27)30(26)33/h7,9,11,13,15,17,21,27H,5-6,8,10,12,14,16,18-20H2,1-4H3 |
| InChIKey | OYRBDCVSHDYPIH-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|