About CID 102424010
CID 102424010 (PubChem CID 102424010) has the molecular formula C31H33NO2+
and a molecular weight of 451.61 g/mol.
Molecular Properties
| Compound Name | CID 102424010 |
| PubChem CID | 102424010 |
| Molecular Formula | C31H33NO2+ |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | — |
| SMILES | CCCCCCCCCC#CC#Cc1ccc(C(=[O+])ONCc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C31H33NO2/c1-2-3-4-5-6-7-8-9-10-11-12-16-26-21-23-28(24-22-26)31(33)34-32-25-29-19-15-18-27-17-13-14-20-30(27)29/h13-15,17-24,32H,2-9,25H2,1H3/q+1 |
| InChIKey | HJULPUJOQURQPY-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 41.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 102424010 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102424010?
The IUPAC name of CID 102424010 (CID 102424010) is not available.
What is the SMILES notation for CID 102424010?
The canonical SMILES for CID 102424010 is CCCCCCCCCC#CC#Cc1ccc(C(=[O+])ONCc2cccc3ccccc23)cc1.
What is the InChIKey of CID 102424010?
The InChIKey is HJULPUJOQURQPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H33NO2/c1-2-3-4-5-6-7-8-9-10-11-12-16-26-21-23-28(24-22-26)31(33)34-32-25-29-19-15-18-27-17-13-14-20-30(27)29/h13-15,17-24,32H,2-9,25H2,1H3/q+1.
What are the key properties of CID 102424010?
CID 102424010 has a molecular weight of 451.61 g/mol, XLogP of 7.20, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102424010 is sourced from PubChem (CID 102424010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).