C34H42O5S — CID 102424475
1-[6-methoxy-4,4-bis(phenylmethoxymethyl)dec-1-ynyl]sulfonyl-4-methylbenzene (PubChem CID 102424475) has the molecular formula C34H42O5S and a molecular weight of 562.77 g/mol. Its IUPAC name is 1-[6-methoxy-4,4-bis(phenylmethoxymethyl)dec-1-ynyl]sulfonyl-4-methylbenzene.
| Compound Name | 1-[6-methoxy-4,4-bis(phenylmethoxymethyl)dec-1-ynyl]sulfonyl-4-methylbenzene |
|---|---|
| PubChem CID | 102424475 |
| Molecular Formula | C34H42O5S |
| Molecular Weight | 562.77 g/mol |
| Exact Mass | 562.28 |
| IUPAC Name | 1-[6-methoxy-4,4-bis(phenylmethoxymethyl)dec-1-ynyl]sulfonyl-4-methylbenzene |
| SMILES | CCCCC(CC(CC#CS(=O)(=O)c1ccc(C)cc1)(COCc1ccccc1)COCc1ccccc1)OC |
| InChI | InChI=1S/C34H42O5S/c1-4-5-17-32(37-3)24-34(27-38-25-30-13-8-6-9-14-30,28-39-26-31-15-10-7-11-16-31)22-12-23-40(35,36)33-20-18-29(2)19-21-33/h6-11,13-16,18-21,32H,4-5,17,22,24-28H2,1-3H3 |
| InChIKey | OMMMDTQWDWMPJL-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.77 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|