C20H30O8 — CID 102425911
[(2R,3S,4S,5R,6R)-5-acetyloxy-3,4-dihydroxy-6-[[(6R)-2,7,7-trimethyl-6-bicyclo[3.1.1]hept-2-enyl]oxy]oxan-2-yl]methyl acetate (PubChem CID 102425911) has the molecular formula C20H30O8 and a molecular weight of 398.45 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-5-acetyloxy-3,4-dihydroxy-6-[[(6R)-2,7,7-trimethyl-6-bicyclo[3.1.1]hept-2-enyl]oxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-5-acetyloxy-3,4-dihydroxy-6-[[(6R)-2,7,7-trimethyl-6-bicyclo[3.1.1]hept-2-enyl]oxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102425911 |
| Molecular Formula | C20H30O8 |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-5-acetyloxy-3,4-dihydroxy-6-[[(6R)-2,7,7-trimethyl-6-bicyclo[3.1.1]hept-2-enyl]oxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](O[C@@H]2C3CC=C(C)C2C3(C)C)[C@H](OC(C)=O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H30O8/c1-9-6-7-12-17(14(9)20(12,4)5)28-19-18(26-11(3)22)16(24)15(23)13(27-19)8-25-10(2)21/h6,12-19,23-24H,7-8H2,1-5H3/t12?,13-,14?,15-,16+,17-,18-,19+/m1/s1 |
| InChIKey | HNOAGZCLPDPBHX-MRXUVKPOSA-N |
| XLogP | 0.94 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|